CymitQuimica logo

CAS 1187929-10-7

:

1H-Pyrrolo[3,2-c]pyridine-2-carboxylic acid, ethyl ester, hydrochloride (1:1)

Description:
1H-Pyrrolo[3,2-c]pyridine-2-carboxylic acid, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyrrolo-pyridine structure, which features a fused bicyclic system. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The ethyl ester group contributes to its lipophilicity, enhancing its potential bioavailability in pharmaceutical applications. The compound may exhibit various biological activities, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its hydrochloride form indicates that it is a salt, which can influence its stability and solubility properties. As with many pyridine derivatives, it may participate in hydrogen bonding and exhibit basicity due to the nitrogen atom in the ring structure. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H10N2O2·ClH
InChI:InChI=1S/C10H10N2O2.ClH/c1-2-14-10(13)9-5-7-6-11-4-3-8(7)12-9;/h3-6,12H,2H2,1H3;1H
InChI key:InChIKey=MCXMYSFSTRVCDM-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC=2C(N1)=CC=NC2.Cl
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine-2-carboxylic acid, ethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.