CAS 1187929-13-0

Piperazine, 1-phenyl-3-(phenylmethyl)-, hydrochloride (1:2)

Description:

Piperazine, 1-phenyl-3-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features a phenyl group and a phenylmethyl group attached to the piperazine ring, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the phenyl groups may influence its interaction with biological targets, potentially affecting its pharmacological profile. The compound is likely to exhibit properties typical of piperazine derivatives, such as anxiolytic or antidepressant effects, although specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a class of piperazine derivatives that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₇H₂₀N₂·2ClH

InChI: InChI=1S/C17H20N2.2ClH/c1-3-7-15(8-4-1)13-16-14-19(12-11-18-16)17-9-5-2-6-10-17;;/h1-10,16,18H,11-14H2;2*1H

InChI key: InChIKey=MOFQAYPZUFGSIE-UHFFFAOYSA-N

SMILES: C(C1CN(CCN1)C2=CC=CC=C2)C3=CC=CC=C3.Cl

Synonyms:

• Piperazine, 1-phenyl-3-(phenylmethyl)-, hydrochloride (1:2)