CAS 1187929-22-1

Pyrazolo[1,5-a]pyridine-7-methanamine, hydrochloride (1:2)

Description:

Pyrazolo[1,5-a]pyridine-7-methanamine, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which combines a pyrazole and pyridine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the methanamine group contributes to its basicity and potential reactivity, making it of interest in medicinal chemistry and drug development. Pyrazolo[1,5-a]pyridine derivatives are often studied for their biological activities, including potential anti-inflammatory, analgesic, and neuroprotective effects. The compound's specific interactions and mechanisms of action would depend on its structural features and functional groups, which can influence its pharmacological properties. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information, and appropriate laboratory safety protocols should be followed when working with this compound.

Formula: C₈H₉N₃·2ClH

InChI: InChI=1S/C8H9N3.2ClH/c9-6-8-3-1-2-7-4-5-10-11(7)8;;/h1-5H,6,9H2;2*1H

InChI key: InChIKey=ZBGQSCBIELLXME-UHFFFAOYSA-N

SMILES: C(N)C=1N2C(=CC=N2)C=CC1.Cl

Synonyms:

• Pyrazolo[1,5-a]pyridine-7-methanamine, hydrochloride (1:2)

1-{Pyrazolo[1,5-a]pyridin-7-yl}methanamine dihydrochloride

CAS: 1187929-22-1

Versatile small molecule scaffold

Formula: C₈H₁₁Cl₂N₃

Purity: Min. 95%

Molecular weight: 220.1 g/mol

Ref: 3D-MXB92922