CymitQuimica logo

CAS 1187929-29-8

:

4-Pyridinamine, 2-fluoro-, hydrochloride (1:2)

Description:
4-Pyridinamine, 2-fluoro-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluoro group at the 2-position and an amino group at the 4-position contributes to its reactivity and potential applications in various chemical reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical contexts. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular interactions can be influenced by the electronegative fluorine atom, which can affect hydrogen bonding and overall polarity. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken due to potential toxicity or reactivity.
Formula:C5H5FN2·2ClH
InChI:InChI=1S/C5H5FN2.2ClH/c6-5-3-4(7)1-2-8-5;;/h1-3H,(H2,7,8);2*1H
InChI key:InChIKey=ZUMIVOIUKCWEFG-UHFFFAOYSA-N
SMILES:NC=1C=C(F)N=CC1.Cl
Synonyms:
  • 4-Pyridinamine, 2-fluoro-, hydrochloride (1:2)
  • 4-Amino-2-fluoropyridine dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.