
CAS 1187929-31-2
:1H-Indazole-3-methanamine, 5-methoxy-, hydrochloride (1:1)
Description:
1H-Indazole-3-methanamine, 5-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a methanamine group at the 3-position and a methoxy group at the 5-position contributes to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its bioavailability in pharmaceutical applications. This compound may exhibit biological activity, potentially influencing neurotransmitter systems, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its pharmacokinetics and pharmacodynamics. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure. Further studies would be necessary to fully elucidate its properties, potential applications, and mechanisms of action in biological systems.
Formula:C9H11N3O·ClH
InChI:InChI=1S/C9H11N3O.ClH/c1-13-6-2-3-8-7(4-6)9(5-10)12-11-8;/h2-4H,5,10H2,1H3,(H,11,12);1H
InChI key:InChIKey=SAYPABUWPQEEPL-UHFFFAOYSA-N
SMILES:C(N)C=1C=2C(NN1)=CC=C(OC)C2.Cl
Synonyms:- 1H-Indazole-3-methanamine, 5-methoxy-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
