CymitQuimica logo

CAS 1187929-32-3

:

4-Chloro-2-fluorobenzenecarboximidamide

Description:
4-Chloro-2-fluorobenzenecarboximidamide is an organic compound characterized by the presence of a benzene ring substituted with both a chlorine and a fluorine atom, as well as a carboximidamide functional group. The chlorine atom is located at the para position relative to the carboximidamide group, while the fluorine is at the meta position. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboximidamide functional group, which can engage in hydrogen bonding. The presence of halogen substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological targets. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.
Formula:C7H6ClFN2
InChI:InChI=1S/C7H6ClFN2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H3,10,11)
InChI key:InChIKey=KDFXGAPXFWKKNG-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=C(F)C=C(Cl)C=C1
Synonyms:
  • Benzenecarboximidamide, 4-chloro-2-fluoro-
  • 4-Chloro-2-fluorobenzenecarboximidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.