CymitQuimica logo

CAS 1187929-37-8

:

1H-Indole, 2,3-dihydro-4-iodo-, hydrochloride (1:1)

Description:
1H-Indole, 2,3-dihydro-4-iodo-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of the dihydro group indicates that the compound has two additional hydrogen atoms, suggesting it is in a saturated form at the 2 and 3 positions of the indole. The iodo substituent at the 4 position introduces significant reactivity and can influence the compound's biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit interesting pharmacological properties, potentially acting as a precursor or intermediate in the synthesis of more complex molecules. Its CAS number, 1187929-37-8, uniquely identifies it in chemical databases, facilitating research and regulatory compliance. Overall, this compound's structural features suggest it may have applications in medicinal chemistry and material science.
Formula:C8H8IN·ClH
InChI:InChI=1S/C8H8IN.ClH/c9-7-2-1-3-8-6(7)4-5-10-8;/h1-3,10H,4-5H2;1H
InChI key:InChIKey=KCMCGYGGYMQFFC-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC=C1)NCC2.Cl
Synonyms:
  • 1H-Indole, 2,3-dihydro-4-iodo-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.