
CAS 1187929-47-0
:Benzenecarboximidamide, 2-fluoro-4-(trifluoromethyl)-, hydrochloride (1:1)
Description:
Benzenecarboximidamide, 2-fluoro-4-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique functional groups and fluorinated structure. It features a benzenecarboximidamide backbone, which is an amide derivative where the carbonyl group is replaced by a carbon-nitrogen double bond. The presence of a trifluoromethyl group and a fluoro substituent on the aromatic ring enhances its lipophilicity and may influence its biological activity. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. This compound may exhibit interesting properties such as potential pharmaceutical applications, given the presence of fluorine, which is known to modulate the pharmacokinetics and pharmacodynamics of organic molecules. Additionally, the presence of the hydrochloride suggests that it may be used in various chemical reactions or as a reagent in synthetic chemistry. Overall, this compound's unique structure and properties make it a subject of interest in both research and industrial applications.
Formula:C8H6F4N2·ClH
InChI:InChI=1S/C8H6F4N2.ClH/c9-6-3-4(8(10,11)12)1-2-5(6)7(13)14;/h1-3H,(H3,13,14);1H
InChI key:InChIKey=GTQFNAMBSVXUCT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(F)=C(C(=N)N)C=C1.Cl
Synonyms:- Benzenecarboximidamide, 2-fluoro-4-(trifluoromethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Fluoro-4-(trifluoromethyl)benzene-1-carboximidamide hydrochloride
CAS:2-Fluoro-4-(trifluoromethyl)benzene-1-carboximidamide hydrochloride
Molecular weight:242.60119g/mol

