CAS 1187929-53-8

1H-Indole, 2,3-dihydro-6-nitro-, hydrochloride (1:1)

Description:

1H-Indole, 2,3-dihydro-6-nitro-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a nitro group at the 6-position of the indole ring indicates that it may exhibit unique electronic properties and potential reactivity. The dihydro form suggests that the compound has two additional hydrogen atoms, which can influence its stability and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in various applications. This compound may be of interest in medicinal chemistry and pharmacology due to its potential biological activities, which could include antimicrobial or anticancer properties. However, specific biological effects and applications would require further investigation and research. Safety data should also be consulted, as nitro compounds can sometimes pose health risks.

Formula: C₈H₈N₂O₂·ClH

InChI: InChI=1S/C8H8N2O2.ClH/c11-10(12)7-2-1-6-3-4-9-8(6)5-7;/h1-2,5,9H,3-4H2;1H

InChI key: InChIKey=SBFNYJDQZRSLKC-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C2C(=CC1)CCN2.Cl

Synonyms:

• 1H-Indole, 2,3-dihydro-6-nitro-, hydrochloride (1:1)

6-Nitro-2,3-dihydro-1h-indole HCl

CAS: 1187929-53-8

Formula: C₈H₉ClN₂O₂

Purity: 95%

Molecular weight: 200.6223

Ref: IN-DA0093KM

6-Nitroindoline hydrochloride

CAS: 1187929-53-8

6-Nitroindoline hydrochloride

Purity: 95%

Molecular weight: 200.62g/mol

Ref: 54-OR1053702