CymitQuimica logo

CAS 1187929-81-2

:

Carbamic acid, N-(3-azetidinylmethyl)-, 1,1-dimethylethyl ester, ethanedioate (1:1)

Description:
Carbamic acid, N-(3-azetidinylmethyl)-, 1,1-dimethylethyl ester, ethanedioate (1:1), identified by CAS number 1187929-81-2, is a chemical compound that features a carbamic acid functional group linked to an azetidine ring. This compound is characterized by its ester functionality, which typically influences its reactivity and solubility properties. The presence of the azetidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. The ethanedioate component indicates that the compound may exhibit properties associated with dicarboxylic acids, such as acidity and potential for forming salts. Overall, this compound's structure suggests it may have unique chemical behavior, including potential for hydrolysis and reactivity with nucleophiles, making it of interest in synthetic organic chemistry and drug design. Further studies would be necessary to elucidate its specific physical properties, biological activity, and potential applications.
Formula:C9H18N2O2·C2H2O4
InChI:InChI=1S/C9H18N2O2.C2H2O4/c1-9(2,3)13-8(12)11-6-7-4-10-5-7;3-1(4)2(5)6/h7,10H,4-6H2,1-3H3,(H,11,12);(H,3,4)(H,5,6)
InChI key:InChIKey=FYIFSQVFDKLMHP-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C(NCC1CNC1)=O.C(C(O)=O)(O)=O
Synonyms:
  • Carbamic acid, N-(3-azetidinylmethyl)-, 1,1-dimethylethyl ester, ethanedioate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.