
CAS 1187929-83-4
:(2R)-1-Cyclopentyl-2-methylpiperazine
Description:
(2R)-1-Cyclopentyl-2-methylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The specific configuration at the second carbon (2R) indicates that it has a chiral center, contributing to its potential biological activity. The presence of a cyclopentyl group and a methyl group at the 1 and 2 positions, respectively, influences its steric and electronic properties, which can affect its interactions with biological targets. This compound may exhibit properties typical of piperazine derivatives, such as potential use in pharmaceuticals, particularly in the development of psychoactive or therapeutic agents. Its solubility, stability, and reactivity can vary based on the functional groups attached and the overall molecular structure. As with many piperazine derivatives, it may also engage in hydrogen bonding and other intermolecular interactions, which are crucial for its biological activity. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.
Formula:C10H20N2
InChI:InChI=1S/C10H20N2/c1-9-8-11-6-7-12(9)10-4-2-3-5-10/h9-11H,2-8H2,1H3/t9-/m1/s1
InChI key:InChIKey=ASZIXIGBMYHICX-SECBINFHSA-N
SMILES:C[C@H]1N(C2CCCC2)CCNC1
Synonyms:- Piperazine, 1-cyclopentyl-2-methyl-, (2R)-
- (2R)-1-Cyclopentyl-2-methylpiperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.