
CAS 1187929-85-6
:Azetidine, 3-(1-methylethoxy)-, ethanedioate (1:1)
Description:
Azetidine, 3-(1-methylethoxy)-, ethanedioate (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 1-methylethoxy group indicates that there is an ethyl group attached to the nitrogen, contributing to the compound's overall stability and reactivity. The ethanedioate component suggests that the compound forms a salt or ester with oxalic acid, which can influence its solubility and interaction with other substances. This compound may exhibit properties typical of azetidines, such as being a potential building block in organic synthesis or pharmaceuticals. Its unique structure allows for various applications, particularly in medicinal chemistry, where azetidine derivatives are explored for their biological activity. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.
Formula:C6H13NO·C2H2O4
InChI:InChI=1S/C6H13NO.C2H2O4/c1-5(2)8-6-3-7-4-6;3-1(4)2(5)6/h5-7H,3-4H2,1-2H3;(H,3,4)(H,5,6)
InChI key:InChIKey=RGFXZUWDICPDCC-UHFFFAOYSA-N
SMILES:O(C(C)C)C1CNC1.C(C(O)=O)(O)=O
Synonyms:- Azetidine, 3-(1-methylethoxy)-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.