CymitQuimica logo

CAS 1187929-92-5

:

2-Azetidinemethanamine, 1-(phenylmethyl)-, hydrochloride (1:1)

Description:
2-Azetidinemethanamine, 1-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which contributes to its unique properties. This compound features a phenylmethyl group, enhancing its potential for interactions with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The presence of the amine functional group suggests that it may engage in hydrogen bonding, influencing its reactivity and interaction with other molecules. Additionally, the compound's molecular structure may impart specific stereochemical properties, affecting its biological activity. While specific pharmacological data may vary, compounds of this nature are often investigated for their potential therapeutic effects, particularly in the fields of medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H16N2·ClH
InChI:InChI=1S/C11H16N2.ClH/c12-8-11-6-7-13(11)9-10-4-2-1-3-5-10;/h1-5,11H,6-9,12H2;1H
InChI key:InChIKey=SMFMCXUZNANXIK-UHFFFAOYSA-N
SMILES:C(N1C(CN)CC1)C2=CC=CC=C2.Cl
Synonyms:
  • 2-Azetidinemethanamine, 1-(phenylmethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.