CAS 1187929-94-7
:3-Pyridinecarboxylic acid, 2-(3-pyrrolidinyloxy)-, hydrochloride (1:1)
Description:
3-Pyridinecarboxylic acid, 2-(3-pyrrolidinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and pyrrolidine moieties, which contribute to its biological activity and potential pharmacological applications. The presence of the carboxylic acid functional group indicates acidic properties, while the hydrochloride form suggests enhanced solubility in aqueous solutions, making it suitable for various formulations. This compound may exhibit interactions with biological targets due to its structural features, potentially influencing neurotransmitter systems or other cellular pathways. Its molecular structure allows for hydrogen bonding and other intermolecular interactions, which can affect its stability and reactivity. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. The compound's characteristics, including its melting point, solubility, and reactivity, would be influenced by the specific arrangement of atoms and functional groups within its structure, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific biological activities and therapeutic potential.
Formula:C10H12N2O3·ClH
InChI:InChI=1S/C10H12N2O3.ClH/c13-10(14)8-2-1-4-12-9(8)15-7-3-5-11-6-7;/h1-2,4,7,11H,3,5-6H2,(H,13,14);1H
InChI key:InChIKey=CHDWDJNYCQKEEY-UHFFFAOYSA-N
SMILES:O(C1=C(C(O)=O)C=CC=N1)C2CCNC2.Cl
Synonyms:- 3-Pyridinecarboxylic acid, 2-(3-pyrrolidinyloxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
