CymitQuimica logo

CAS 1187930-04-6

:

Oxazolo[4,5-c]pyridine, 2-(4-bromophenyl)-4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:
Oxazolo[4,5-c]pyridine, 2-(4-bromophenyl)-4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which combines an oxazole and pyridine ring. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a 4-bromophenyl substituent that enhances its potential reactivity and biological activity. The hydrochloride form suggests that the compound is a salt, which typically improves its solubility in water and stability. This substance may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on the functional groups present and the overall molecular structure. As with many heterocyclic compounds, it may also participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions, which are valuable in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of bromine, which can pose health risks.
Formula:C12H11BrN2O·ClH
InChI:InChI=1S/C12H11BrN2O.ClH/c13-9-3-1-8(2-4-9)12-15-10-7-14-6-5-11(10)16-12;/h1-4,14H,5-7H2;1H
InChI key:InChIKey=VYZUMCLFRFNGOR-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C2=NC3=C(O2)CCNC3)C=C1.Cl
Synonyms:
  • Oxazolo[4,5-c]pyridine, 2-(4-bromophenyl)-4,5,6,7-tetrahydro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.