
CAS 1187930-05-7
:4,7-Diazaspiro[2.5]octane-4-carboxylic acid, phenylmethyl ester, ethanedioate (1:1)
Description:
4,7-Diazaspiro[2.5]octane-4-carboxylic acid, phenylmethyl ester, ethanedioate (1:1), identified by CAS number 1187930-05-7, is a chemical compound characterized by its unique spirocyclic structure, which incorporates two nitrogen atoms within a bicyclic framework. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of the phenylmethyl ester indicates that it has an aromatic component, which can influence its solubility and interaction with other molecules. The ethanedioate component suggests the presence of oxalic acid derivatives, which may impart additional properties such as chelation ability or reactivity with metal ions. Overall, this compound may exhibit interesting biological or pharmacological activities due to its complex structure, making it a subject of interest in medicinal chemistry and material science. Its specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise applications and behavior in various chemical environments.
Formula:C14H18N2O2·C2H2O4
InChI:InChI=1S/C14H18N2O2.C2H2O4/c17-13(18-10-12-4-2-1-3-5-12)16-9-8-15-11-14(16)6-7-14;3-1(4)2(5)6/h1-5,15H,6-11H2;(H,3,4)(H,5,6)
InChI key:InChIKey=KEPPEDGOWWILDZ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2C3(CC3)CNCC2.C(C(O)=O)(O)=O
Synonyms:- 4,7-Diazaspiro[2.5]octane-4-carboxylic acid, phenylmethyl ester, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.