CAS 1187930-09-1

Piperazine, 2-(phenylmethyl)-, hydrochloride (1:2)

Description:

Piperazine, 2-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a phenylmethyl group attached to one of the nitrogen atoms in the piperazine ring, enhancing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for various applications, particularly in pharmaceuticals. The presence of the hydrochloride form indicates that it can exist as a stable crystalline solid, facilitating handling and storage. Piperazine derivatives are known for their diverse biological activities, including potential use as anxiolytics, antidepressants, and in the treatment of certain parasitic infections. The compound's molecular structure contributes to its interaction with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₁H₁₆N₂·2ClH

InChI: InChI=1S/C11H16N2.2ClH/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11;;/h1-5,11-13H,6-9H2;2*1H

InChI key: InChIKey=JHRUMWHRCFWZKW-UHFFFAOYSA-N

SMILES: C(C1=CC=CC=C1)C2CNCCN2.Cl

Synonyms:

• Piperazine, 2-(phenylmethyl)-, hydrochloride (1:2)

2-Benzyl-piperazine-2hcl

CAS: 1187930-09-1

Formula: C₁₁H₁₈Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 249.1800

Ref: IN-DA0092FE

2-Benzylpiperazine dihydrochloride

CAS: 1187930-09-1

2-Benzylpiperazine dihydrochloride

Purity: 95%

Molecular weight: 249.19g/mol

Ref: 54-OR1050702

2-Benzylpiperazine dihydrochloride

CAS: 1187930-09-1

Formula: C₁₁H₁₈Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 249.18

Ref: 10-F091503