CymitQuimica logo

CAS 1187930-22-8

:

6-Amino-2-bromo-3-pyridinol

Description:
6-Amino-2-bromo-3-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) at the 6-position and a bromo substituent at the 2-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the amino group. Its structure suggests that it could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in the synthesis of pharmaceuticals or agrochemicals. The bromine atom can serve as a leaving group in reactions, while the amino group can act as a nucleophile. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential therapeutic applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H5BrN2O
InChI:InChI=1S/C5H5BrN2O/c6-5-3(9)1-2-4(7)8-5/h1-2,9H,(H2,7,8)
InChI key:InChIKey=WGXNFINAFBXTNB-UHFFFAOYSA-N
SMILES:BrC1=C(O)C=CC(N)=N1
Synonyms:
  • 3-Pyridinol, 6-amino-2-bromo-
  • 6-Amino-2-bromo-3-pyridinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.