CAS 1187930-27-3

Methyl 4-amino-2-benzoxazolecarboxylate

Description:

Methyl 4-amino-2-benzoxazolecarboxylate is an organic compound characterized by its benzoxazole structure, which features a fused benzene and oxazole ring. This compound typically exhibits a molecular formula that includes a methyl ester functional group, contributing to its solubility in organic solvents. The presence of the amino group enhances its potential for hydrogen bonding, influencing its reactivity and interaction with other chemical species. Methyl 4-amino-2-benzoxazolecarboxylate may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis often involves the reaction of appropriate starting materials under controlled conditions to ensure the formation of the desired product. The compound's stability, melting point, and solubility can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₉H₈N₂O₃

InChI: InChI=1S/C9H8N2O3/c1-13-9(12)8-11-7-5(10)3-2-4-6(7)14-8/h2-4H,10H2,1H3

InChI key: InChIKey=KODJCWKZCJPUDY-UHFFFAOYSA-N

SMILES: NC1=C2C(OC(C(OC)=O)=N2)=CC=C1

Synonyms:

• 2-Benzoxazolecarboxylic acid, 4-amino-, methyl ester
• Methyl 4-amino-2-benzoxazolecarboxylate