CAS 1187930-29-5
:4-Pyridinamine, 2-phenyl-, hydrochloride (1:1)
Description:
4-Pyridinamine, 2-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and phenyl functional groups. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. The presence of the pyridinamine structure suggests that it may exhibit basic properties due to the nitrogen atom in the pyridine ring, which can participate in protonation. This compound may be of interest in various fields, including medicinal chemistry, due to its potential biological activity. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in drug development. Additionally, the hydrochloride form often improves the compound's handling and storage properties. Safety data sheets should be consulted for information on toxicity and handling precautions, as with any chemical substance. Overall, 4-Pyridinamine, 2-phenyl-, hydrochloride (1:1) represents a versatile compound with potential applications in research and industry.
Formula:C11H10N2·ClH
InChI:InChI=1S/C11H10N2.ClH/c12-10-6-7-13-11(8-10)9-4-2-1-3-5-9;/h1-8H,(H2,12,13);1H
InChI key:InChIKey=FQILZKVLVWTURE-UHFFFAOYSA-N
SMILES:NC=1C=C(N=CC1)C2=CC=CC=C2.Cl
Synonyms:- 4-Pyridinamine, 2-phenyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
