CAS 1187930-41-1

4-Piperidinamine, N-cyclohexyl-1-methyl-, hydrochloride (1:2)

Description:

4-Piperidinamine, N-cyclohexyl-1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a cyclohexyl group and a methyl group attached to the nitrogen of the piperidine, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceutical formulations. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The compound may exhibit characteristics such as basicity due to the nitrogen atom, and it may participate in hydrogen bonding, influencing its interactions in biological systems. Safety and handling precautions are essential, as with many amines and their salts, due to potential toxicity and reactivity. Overall, this compound is of interest in medicinal chemistry and related fields for its structural features and potential applications.

Formula: C₁₂H₂₄N₂·2ClH

InChI: InChI=1S/C12H24N2.2ClH/c1-14-9-7-12(8-10-14)13-11-5-3-2-4-6-11;;/h11-13H,2-10H2,1H3;2*1H

InChI key: InChIKey=PGMORNGXAPFTEY-UHFFFAOYSA-N

SMILES: N(C1CCN(C)CC1)C2CCCCC2.Cl

Synonyms:

• 4-Piperidinamine, N-cyclohexyl-1-methyl-, hydrochloride (1:2)