CymitQuimica logo

CAS 1187930-42-2

:

5H-Cyclopenta[b]pyridin-7-amine, 6,7-dihydro-, hydrochloride (1:1)

Description:
5H-Cyclopenta[b]pyridin-7-amine, 6,7-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which consists of a cyclopentane fused to a pyridine ring. This compound features an amine functional group, contributing to its basicity and potential reactivity in various chemical reactions. The hydrochloride salt form indicates that the amine is protonated, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the hydrochloride also suggests that it may be used in drug formulations, where stability and bioavailability are critical. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods. Overall, this compound represents a unique scaffold that may be explored for its pharmacological potential and utility in synthetic chemistry.
Formula:C8H10N2·ClH
InChI:InChI=1S/C8H10N2.ClH/c9-7-4-3-6-2-1-5-10-8(6)7;/h1-2,5,7H,3-4,9H2;1H
InChI key:InChIKey=ZJMHTKKYRWAVTH-UHFFFAOYSA-N
SMILES:NC1C=2C(=CC=CN2)CC1.Cl
Synonyms:
  • 5H-Cyclopenta[b]pyridin-7-amine, 6,7-dihydro-, hydrochloride (1:1)
Found 4 products.