
CAS 1187930-45-5
:2-Piperidinone, 6-(aminomethyl)-, ethanedioate (1:1)
Description:
2-Piperidinone, 6-(aminomethyl)-, ethanedioate (1:1) is a chemical compound characterized by its piperidinone structure, which features a six-membered ring containing a nitrogen atom and a carbonyl group. The presence of an aminomethyl group indicates that there is an amino group attached to a methylene bridge, enhancing its potential for reactivity and interaction with other molecules. The ethanedioate component suggests that the compound forms a salt or complex with oxalic acid, which can influence its solubility and stability in various solvents. This compound may exhibit properties typical of both amines and carboxylic acids, such as basicity and the ability to form hydrogen bonds. Its applications could span across pharmaceuticals, where it may serve as an intermediate in the synthesis of biologically active compounds, or in materials science. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the precise conditions and purity of the substance. As with any chemical, safety data and handling precautions should be consulted prior to use.
Formula:C6H12N2O·C2H2O4
InChI:InChI=1S/C6H12N2O.C2H2O4/c7-4-5-2-1-3-6(9)8-5;3-1(4)2(5)6/h5H,1-4,7H2,(H,8,9);(H,3,4)(H,5,6)
InChI key:InChIKey=ZHGPIQOFXOZMHN-UHFFFAOYSA-N
SMILES:C(N)C1NC(=O)CCC1.C(C(O)=O)(O)=O
Synonyms:- 2-Piperidinone, 6-(aminomethyl)-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.