CAS 1187930-48-8

3-Pyridinemethanamine, 4-(trifluoromethyl)-, ethanedioate (1:1)

Description:

3-Pyridinemethanamine, 4-(trifluoromethyl)-, ethanedioate (1:1), with the CAS number 1187930-48-8, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 4-position of the pyridine ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The ethanedioate component indicates that the compound forms a salt or complex with oxalic acid, which may affect its solubility and stability in various solvents. This compound may exhibit interesting pharmacological properties due to the combination of the pyridine moiety and the trifluoromethyl group, making it a subject of interest in medicinal chemistry. Additionally, the presence of the ethanedioate suggests potential applications in coordination chemistry or as a ligand in metal complexes. Overall, the unique structural features of this compound contribute to its potential utility in various chemical and pharmaceutical applications.

Formula: C₇H₇F₃N₂·C₂H₂O₄

InChI: InChI=1S/C7H7F3N2.C2H2O4/c8-7(9,10)6-1-2-12-4-5(6)3-11;3-1(4)2(5)6/h1-2,4H,3,11H2;(H,3,4)(H,5,6)

InChI key: InChIKey=CINDLJCBRYAPMC-UHFFFAOYSA-N

SMILES: C(N)C=1C(C(F)(F)F)=CC=NC1.C(C(O)=O)(O)=O

Synonyms:

• 3-Pyridinemethanamine, 4-(trifluoromethyl)-, ethanedioate (1:1)