CymitQuimica logo

CAS 1187930-50-2

:

2-Pyrimidineethanamine, 4-phenyl-, hydrochloride (1:2)

Description:
2-Pyrimidineethanamine, 4-phenyl-, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a pyrimidine ring and an ethylamine side chain, along with a phenyl group. This compound typically appears as a hydrochloride salt, indicating that it is a protonated form, which enhances its solubility in water. The presence of the pyrimidine moiety suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The compound may exhibit properties such as basicity due to the amine group, and it could participate in hydrogen bonding due to the presence of nitrogen atoms. Its hydrochloride form is often utilized in biological studies and medicinal chemistry due to improved stability and bioavailability. As with many organic compounds, safety data should be consulted, as it may pose risks such as irritation or toxicity depending on exposure levels. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications.
Formula:C12H15Cl2N3
InChI:InChI=1S/C12H13N3.2ClH/c13-8-6-12-14-9-7-11(15-12)10-4-2-1-3-5-10;;/h1-5,7,9H,6,8,13H2;2*1H
InChI key:InChIKey=KIJJUWWEGPOYEI-UHFFFAOYSA-N
SMILES:C(CN)C=1N=C(C=CN1)C2=CC=CC=C2.Cl
Synonyms:
  • 2-Pyrimidineethanamine, 4-phenyl-, hydrochloride (1:2)
  • 2-(4-PHENYL-PYRIMIDIN-2-YL)-ETHYLAMINE DIHYDROCHLORIDE
  • [2-(4-phenyl-2-pyrimidinyl)ethyl]amine dihydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.