CAS 1187930-52-4

9H-Fluorene-9-methanamine, N-methyl-, hydrochloride (1:1)

Description:

9H-Fluorene-9-methanamine, N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its structure, which features a fluorene backbone with a methanamine group and a methyl substitution. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, making it relevant in organic synthesis and medicinal chemistry. The fluorene moiety contributes to its potential as a building block in the development of organic materials, including dyes and pharmaceuticals. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological profile. As with many amines, it is important to consider its reactivity, particularly in the presence of electrophiles or under acidic conditions. Safety data and handling precautions should be observed due to its classification and potential effects.

Formula: C₁₅H₁₅N·ClH

InChI: InChI=1S/C15H15N.ClH/c1-16-10-15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15;/h2-9,15-16H,10H2,1H3;1H

InChI key: InChIKey=ZBZZHNNYQRGHHO-UHFFFAOYSA-N

SMILES: C(NC)C1C=2C(C=3C1=CC=CC3)=CC=CC2.Cl

Synonyms:

• 9H-Fluorene-9-methanamine, N-methyl-, hydrochloride (1:1)