CAS 1187930-71-7

3-[(1R)-1-Aminoethyl]benzoic acid

Description:

3-[(1R)-1-Aminoethyl]benzoic acid, identified by its CAS number 1187930-71-7, is an organic compound characterized by the presence of both an amino group and a carboxylic acid functional group. This compound features a benzoic acid backbone, with an aminoethyl side chain attached at the meta position relative to the carboxylic acid group. The (1R)-configuration indicates that the aminoethyl group is in a specific stereochemical arrangement, which can influence the compound's biological activity and interactions. Typically, compounds of this nature may exhibit properties such as solubility in polar solvents, potential for hydrogen bonding due to the amino and carboxylic acid groups, and the ability to participate in various chemical reactions, including amide formation and acid-base reactions. The presence of both functional groups suggests that it may have applications in pharmaceuticals or biochemistry, particularly in the development of drugs or as a biochemical probe. Further characterization would involve studying its physical properties, reactivity, and potential biological effects.

Formula: C₉H₁₁NO₂

InChI: InChI=1S/C9H11NO2/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-6H,10H2,1H3,(H,11,12)/t6-/m1/s1

InChI key: InChIKey=NSRCJWRFTUMEEL-ZCFIWIBFSA-N

SMILES: [C@H](C)(N)C1=CC(C(O)=O)=CC=C1

Synonyms:

• Benzoic acid, 3-[(1R)-1-aminoethyl]-
• (R)-3-(1-Aminoethyl)benzoic acid
• 3-[(1R)-1-Aminoethyl]benzoic acid
• (R)-3-(1-Amino-ethyl)-benzoic acid