CymitQuimica logo

CAS 1187930-73-9

:

9H-Fluoren-9-ylmethyl (2R)-2-methyl-1-piperazinecarboxylate

Description:
9H-Fluoren-9-ylmethyl (2R)-2-methyl-1-piperazinecarboxylate is a chemical compound characterized by its unique structure, which includes a fluorenylmethyl group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in organic solvents. The presence of the piperazine ring suggests that it may exhibit basic properties due to the nitrogen atoms, which can participate in hydrogen bonding and interact with biological targets. The (2R)-2-methyl configuration indicates stereochemistry that may influence its biological activity and interactions. As a derivative of piperazine, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential effects on neurotransmitter systems. Its specific applications and reactivity would depend on further studies, including its synthesis, stability, and interaction with other chemical entities. Overall, this compound represents a blend of structural features that could be explored for various chemical and biological applications.
Formula:C20H22N2O2
InChI:InChI=1S/C20H22N2O2/c1-14-12-21-10-11-22(14)20(23)24-13-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19/h2-9,14,19,21H,10-13H2,1H3/t14-/m1/s1
InChI key:InChIKey=KKHIFBVXMMTWHI-CQSZACIVSA-N
SMILES:C(OC(=O)N1[C@H](C)CNCC1)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:
  • 9H-Fluoren-9-ylmethyl (2R)-2-methyl-1-piperazinecarboxylate
  • 1-Piperazinecarboxylic acid, 2-methyl-, 9H-fluoren-9-ylmethyl ester, (2R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.