CAS 1187930-78-4: 2-[(1R)-1-Aminoethyl]benzoic acid

Description: 2-[(1R)-1-Aminoethyl]benzoic acid, also known as a derivative of benzoic acid, features an aminoethyl side chain attached to the benzene ring. This compound is characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH), which contribute to its properties as an amino acid derivative. The (1R) configuration indicates that the aminoethyl group is in a specific stereochemical arrangement, which can influence the compound's biological activity and interactions. This substance is likely to exhibit polar characteristics due to the functional groups, making it soluble in water and capable of forming hydrogen bonds. Its structure suggests potential applications in pharmaceuticals, particularly in the development of drugs that target specific biological pathways. Additionally, the presence of both acidic and basic functional groups allows it to act as a zwitterion under certain pH conditions, further enhancing its reactivity and interaction with other molecules. Overall, 2-[(1R)-1-Aminoethyl]benzoic acid is a versatile compound with significant implications in medicinal chemistry.

Formula: C₉H₁₁NO₂

InChI: InChI=1S/C9H11NO2/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-6H,10H2,1H3,(H,11,12)/t6-/m1/s1

InChI key: InChIKey=KYZTUNCFUQURFU-ZCFIWIBFSA-N

SMILES: O=C(O)C=1C=CC=CC1C(N)C

Synonyms:

• 2-[(1R)-1-Aminoethyl]benzoic acid
• Benzoic acid, 2-[(1R)-1-aminoethyl]-

(R)-2-(1-aminoethyl)benzoic acid

CAS: 1187930-78-4

• Purity: 98%
• Molecular weight: 165.19200134277344

(R)-2-(1-Amino-ethyl)-benzoic acid

CAS: 1187930-78-4

Please enquire for more information about (R)-2-(1-Amino-ethyl)-benzoic acid including the price, delivery time and more …

• Formula: C₉H₁₁NO₂
• Purity: Min. 95%
• Molecular weight: 165.19 g/mol