CymitQuimica logo

CAS 1187930-82-0

:

5-Thiazoleethanamine, 2-phenyl-, hydrochloride (1:1)

Description:
5-Thiazoleethanamine, 2-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its thiazole and phenyl functional groups, which contribute to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The thiazole ring imparts biological activity, often associated with antimicrobial and anti-inflammatory properties, while the phenyl group can influence the compound's lipophilicity and overall pharmacokinetics. This compound may be utilized in medicinal chemistry for the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, making it a subject of interest in drug discovery. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, 5-Thiazoleethanamine, 2-phenyl-, hydrochloride (1:1) represents a versatile compound with potential applications in various fields, particularly in medicinal chemistry and research.
Formula:C11H12N2S·ClH
InChI:InChI=1S/C11H12N2S.ClH/c12-7-6-10-8-13-11(14-10)9-4-2-1-3-5-9;/h1-5,8H,6-7,12H2;1H
InChI key:InChIKey=UDKURZXPAWKQNR-UHFFFAOYSA-N
SMILES:C(CN)C=1SC(=NC1)C2=CC=CC=C2.Cl
Synonyms:
  • 5-Thiazoleethanamine, 2-phenyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.