CAS 1187930-92-2: 1,1-Dimethylethyl 4-aminohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate
Description:1,1-Dimethylethyl 4-aminohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate, identified by its CAS number 1187930-92-2, is a chemical compound that features a complex structure characterized by a cyclopentane ring fused with a pyrrole moiety. This compound contains a dimethyl group, which contributes to its steric properties, and an amino group that may participate in hydrogen bonding and other interactions. The carboxylate functional group indicates potential for reactivity, particularly in esterification or amidation reactions. Its molecular structure suggests it may exhibit interesting biological activity, making it a candidate for pharmaceutical applications. The presence of multiple functional groups implies that it could engage in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent polarity. Overall, this compound's unique structural features and functional groups make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C12H22N2O2
InChI:InChI=1S/C12H22N2O2/c1-12(2,3)16-11(15)14-6-8-4-5-10(13)9(8)7-14/h8-10H,4-7,13H2,1-3H3
InChI key:InChIKey=VMUXGMBHACBHJJ-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)N1CC2CCC(N)C2C1
- Synonyms:
- 2-n-Boc-octahydrocyclopenta[c] pyrrol-4-amine
- Cyclopenta[c]pyrrole-2(1H)-carboxylic acid, 4-aminohexahydro-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-aminohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate
- tert-Butyl 4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate
![discount label](https://static.cymitquimica.com/public/img/discount.png)
4-AMINO-HEXAHYDRO-CYCLOPENTA[C]PYRROLE-2-CARBOXYLIC ACID TERT-BUTYL ESTER
Ref: IN-DA008ROW
1g | 644.00 € | ||
100mg | 205.00 € | ||
250mg | 274.00 € | ||
500mg | 608.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
tert-Butyl 4-aminohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate
Ref: 54-OR85658
1g | 940.00 € | ||
250mg | 396.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-N-BOC-OCTAHYDROCYCLOPENTA[C] PYRROL-4-AMINE
Ref: 10-F333871
1g | 478.00 € | ||
100mg | 150.00 € | ||
250mg | 213.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
4-Amino-hexahydro-cyclopenta[c]pyrrole-2-carboxylic acid tert-butyl ester
Ref: 3D-FA56533
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |