CAS 1187930-96-6

Piperazine, 1-cyclohexyl-3-methyl-, (3R)-, ethanedioate (1:1)

Description:

Piperazine, 1-cyclohexyl-3-methyl-, (3R)-, ethanedioate (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This specific derivative features a cyclohexyl group and a methyl group attached to the piperazine ring, contributing to its unique properties. The ethanedioate component indicates the presence of an oxalic acid derivative, suggesting that the compound may form a salt or complex with certain cations. The (3R)- designation refers to the specific stereochemistry at the piperazine's third position, which can influence the compound's biological activity and interactions. Generally, piperazine derivatives are known for their pharmacological properties, including potential applications in medicinal chemistry, particularly as anxiolytics or antidepressants. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the presence of functional groups. Overall, this compound represents a specific class of piperazine derivatives with potential relevance in various chemical and pharmaceutical contexts.

Formula: C₁₁H₂₂N₂·C₂H₂O₄

InChI: InChI=1S/C11H22N2.C2H2O4/c1-10-9-13(8-7-12-10)11-5-3-2-4-6-11;3-1(4)2(5)6/h10-12H,2-9H2,1H3;(H,3,4)(H,5,6)/t10-;/m1./s1

InChI key: InChIKey=YDHMUFNOZYBUFH-HNCPQSOCSA-N

SMILES: C[C@@H]1CN(CCN1)C2CCCCC2.C(C(O)=O)(O)=O

Synonyms:

• Piperazine, 1-cyclohexyl-3-methyl-, (3R)-, ethanedioate (1:1)