CAS 1187931-07-2
:(3R)-3-Amino-1-pyrrolidineacetic acid
Description:
(3R)-3-Amino-1-pyrrolidineacetic acid, also known as a pyrrolidine derivative, is an amino acid analog characterized by its unique cyclic structure, which includes a pyrrolidine ring. This compound features an amino group and a carboxylic acid functional group, making it a chiral molecule with potential biological activity. The presence of the pyrrolidine ring contributes to its conformational flexibility, which can influence its interactions with biological targets. It is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs that modulate neurotransmitter systems or exhibit neuroprotective properties. The specific stereochemistry at the 3-position is crucial for its biological activity, as it can affect receptor binding and efficacy. Additionally, this compound may exhibit solubility in polar solvents, and its stability can be influenced by pH and temperature. Overall, (3R)-3-Amino-1-pyrrolidineacetic acid represents a significant area of interest in medicinal chemistry and drug design.
Formula:C6H12N2O2
InChI:InChI=1S/C6H12N2O2/c7-5-1-2-8(3-5)4-6(9)10/h5H,1-4,7H2,(H,9,10)/t5-/m1/s1
InChI key:InChIKey=CVERFTFADAXMTR-RXMQYKEDSA-N
SMILES:C(C(O)=O)N1C[C@H](N)CC1
Synonyms:- 1-Pyrrolidineacetic acid, 3-amino-, (3R)-
- (3R)-3-Amino-1-pyrrolidineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
