CAS 1187931-20-9
:Piperazine, 2-(4-methoxyphenyl)-, acetate (1:1)
Description:
Piperazine, 2-(4-methoxyphenyl)-, acetate (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 4-methoxyphenyl group indicates a methoxy substituent on a phenyl ring, contributing to its aromatic properties and potentially influencing its biological activity. The acetate component suggests that the compound is a salt or ester formed with acetic acid, which may enhance its solubility and stability. This compound may exhibit various pharmacological properties, as piperazine derivatives are often investigated for their potential use in medicinal chemistry, particularly in the development of anxiolytics, antidepressants, and other therapeutic agents. Its molecular structure and functional groups can affect its reactivity, solubility, and interaction with biological targets. As with many chemical substances, safety and handling precautions should be observed, and its use should be guided by relevant regulatory standards and research findings.
Formula:C11H16N2O·C2H4O2
InChI:InChI=1S/C11H16N2O.C2H4O2/c1-14-10-4-2-9(3-5-10)11-8-12-6-7-13-11;1-2(3)4/h2-5,11-13H,6-8H2,1H3;1H3,(H,3,4)
InChI key:InChIKey=LSXZIYSXUKXZSU-UHFFFAOYSA-N
SMILES:O(C)C1=CC=C(C=C1)C2CNCCN2.C(C)(O)=O
Synonyms:- Piperazine, 2-(4-methoxyphenyl)-, acetate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
