CAS 1187931-30-1
:(2R)-1-Ethyl-2-methylpiperazine
Description:
(2R)-1-Ethyl-2-methylpiperazine is a chemical compound characterized by its piperazine structure, which consists of a six-membered ring containing two nitrogen atoms. This specific isomer features an ethyl group at the nitrogen atom in the 1-position and a methyl group at the 2-position, contributing to its chiral nature. The compound is typically colorless to pale yellow and may have a distinctive amine-like odor. It is soluble in water and organic solvents, reflecting its polar nature due to the presence of nitrogen atoms. (2R)-1-Ethyl-2-methylpiperazine is of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential as a building block for more complex molecules. Its biological activity may be influenced by its stereochemistry, making it relevant in medicinal chemistry. Safety data should be consulted for handling, as it may pose health risks typical of amine compounds, including irritation or toxicity upon exposure.
Formula:C7H16N2
InChI:InChI=1S/C7H16N2/c1-3-9-5-4-8-6-7(9)2/h7-8H,3-6H2,1-2H3/t7-/m1/s1
InChI key:InChIKey=AKCOBIDAJNERRN-SSDOTTSWSA-N
SMILES:C(C)N1[C@H](C)CNCC1
Synonyms:- (R)-1-Ethyl-2-methyl-piperazine
- (2R)-1-Ethyl-2-methylpiperazine
- Piperazine, 1-ethyl-2-methyl-, (2R)-
- (R)-1-Ethyl-2-methylpiperazine
- (R)-1-ETHYL-2-METHYLPIPERAZINE 2HCL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.