CymitQuimica logo

CAS 1187931-33-4

:

(3S)-3-Amino-1-pyrrolidineacetic acid

Description:
(3S)-3-Amino-1-pyrrolidineacetic acid, also known as a pyrrolidine derivative, is an amino acid analog characterized by its unique five-membered ring structure containing a nitrogen atom. This compound features a chiral center, which contributes to its stereochemistry, specifically the (3S) configuration. It is soluble in water, making it suitable for various biological applications. The presence of both an amino group and a carboxylic acid group allows it to participate in typical amino acid reactions, such as peptide bond formation. This compound may exhibit biological activity, potentially influencing neurotransmitter systems or serving as a building block in the synthesis of more complex molecules. Its structural properties may also allow it to interact with specific receptors or enzymes, making it of interest in medicinal chemistry and drug development. As with many amino acid derivatives, it may be studied for its potential therapeutic applications, particularly in neurology or psychiatry, due to its structural similarity to naturally occurring amino acids.
Formula:C6H12N2O2
InChI:InChI=1S/C6H12N2O2/c7-5-1-2-8(3-5)4-6(9)10/h5H,1-4,7H2,(H,9,10)/t5-/m0/s1
InChI key:InChIKey=CVERFTFADAXMTR-YFKPBYRVSA-N
SMILES:C(C(O)=O)N1C[C@@H](N)CC1
Synonyms:
  • (3S)-3-Amino-1-pyrrolidineacetic acid
  • 1-Pyrrolidineacetic acid, 3-amino-, (3S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.