
CAS 1187931-48-1
:4-Pyridinecarboxylic acid, 2-(3-methyl-1-piperidinyl)-, hydrochloride (1:1)
Description:
4-Pyridinecarboxylic acid, 2-(3-methyl-1-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its biological activity and solubility properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the carboxylic acid functional group suggests potential for hydrogen bonding and reactivity, while the piperidine ring may impart basicity and influence the compound's interaction with biological targets. This compound may exhibit properties such as antimicrobial or analgesic activity, common among similar structures. Its molecular structure allows for various forms of intermolecular interactions, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C12H16N2O2·ClH
InChI:InChI=1S/C12H16N2O2.ClH/c1-9-3-2-6-14(8-9)11-7-10(12(15)16)4-5-13-11;/h4-5,7,9H,2-3,6,8H2,1H3,(H,15,16);1H
InChI key:InChIKey=AGEMASPFMIABTB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(N=CC1)N2CC(C)CCC2.Cl
Synonyms:- 4-Pyridinecarboxylic acid, 2-(3-methyl-1-piperidinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.