CAS 1187931-61-8

1H-Imidazole-5-methanol, 1-ethyl-, hydrochloride (1:1)

Description:

1H-Imidazole-5-methanol, 1-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance is typically a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The imidazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs that target various biological pathways. The presence of the ethyl group may influence its lipophilicity and overall pharmacokinetic properties. As a hydrochloride salt, it is often more stable and easier to handle than its free base counterpart. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₆H₁₀N₂O·ClH

InChI: InChI=1S/C6H10N2O.ClH/c1-2-8-5-7-3-6(8)4-9;/h3,5,9H,2,4H2,1H3;1H

InChI key: InChIKey=QYCAPGNILPXRKS-UHFFFAOYSA-N

SMILES: C(O)C=1N(CC)C=NC1.Cl

Synonyms:

• 1H-Imidazole-5-methanol, 1-ethyl-, hydrochloride (1:1)

(1-Ethyl-1H-imidazol-5-yl)methanol hydrochloride

CAS: 1187931-61-8

(1-Ethyl-1H-imidazol-5-yl)methanol hydrochloride

Purity: 96%

Molecular weight: 162.62g/mol

Ref: 54-OR1066316