
CAS 1187931-65-2
:3-Pyrrolidinecarboxylic acid, 2-phenyl-, hydrochloride (1:1), (2R,3R)-rel-
Description:
3-Pyrrolidinecarboxylic acid, 2-phenyl-, hydrochloride (1:1), (2R,3R)-rel- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and a phenyl substituent, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which often enhances solubility in water and stability. The (2R,3R)-rel- designation refers to its specific stereochemistry, indicating that the compound has two chiral centers with a particular spatial arrangement. Such stereochemical configurations can significantly influence the compound's pharmacological properties, including its interaction with biological targets. This compound may be of interest in medicinal chemistry and pharmaceutical research due to its structural features, which could be relevant for developing therapeutic agents. As with many organic compounds, its properties, such as solubility, melting point, and reactivity, would depend on the specific conditions and environment in which it is studied.
Formula:C11H13NO2.ClH
InChI:InChI=1/C11H13NO2.ClH/c13-11(14)9-6-7-12-10(9)8-4-2-1-3-5-8;/h1-5,9-10,12H,6-7H2,(H,13,14);1H/t9-,10+;/s2
InChI key:InChIKey=CLBXHARXLYHVIZ-RXWGLGACNA-N
SMILES:C(O)(=O)[C@@H]1[C@](NCC1)(C2=CC=CC=C2)[H].Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.