
CAS 1187931-72-1
:Pyrrolidine, 3-[4-(1,1-dimethylethoxy)phenyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[4-(1,1-dimethylethoxy)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The compound features a phenyl group substituted with a 1,1-dimethylethoxy group, contributing to its lipophilicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the hydrochloride indicates that the compound can exist in a protonated form, which may influence its stability, solubility, and interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and detailed applications would require further investigation through empirical studies and literature review. As with any chemical substance, proper handling and safety protocols should be observed due to potential hazards associated with its use.
Formula:C14H21NO·ClH
InChI:InChI=1S/C14H21NO.ClH/c1-14(2,3)16-13-6-4-11(5-7-13)12-8-9-15-10-12;/h4-7,12,15H,8-10H2,1-3H3;1H
InChI key:InChIKey=ANTHMWNELCKNNE-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C1=CC=C(C=C1)C2CCNC2.Cl
Synonyms:- Pyrrolidine, 3-[4-(1,1-dimethylethoxy)phenyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.