CAS 1187931-77-6

Imidazo[1,2-a]pyridine-2-methanamine, N,5-dimethyl-, hydrochloride (1:2)

Description:

Imidazo[1,2-a]pyridine-2-methanamine, N,5-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused ring system that includes both imidazole and pyridine moieties. This compound typically exists as a hydrochloride salt, enhancing its solubility in water and making it more suitable for various applications, particularly in biological and pharmaceutical contexts. The presence of the N,5-dimethyl substituents indicates that there are two methyl groups attached to the nitrogen atom at the 5-position of the imidazo-pyridine ring, which can influence its pharmacological properties and interactions. The compound may exhibit biological activity, potentially acting as a ligand or inhibitor in various biochemical pathways. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other interactions that are relevant in medicinal chemistry.

Formula: C₁₀H₁₃N₃·2ClH

InChI: InChI=1S/C10H13N3.2ClH/c1-8-4-3-5-10-12-9(6-11-2)7-13(8)10;;/h3-5,7,11H,6H2,1-2H3;2*1H

InChI key: InChIKey=QRNBXAMPGCXMBX-UHFFFAOYSA-N

SMILES: CC=1N2C(=NC(CNC)=C2)C=CC1.Cl

Synonyms:

• Imidazo[1,2-a]pyridine-2-methanamine, N,5-dimethyl-, hydrochloride (1:2)