CymitQuimica logo

CAS 1187931-90-3

:

1H-Pyrido[4,3-b]indole, 8-chloro-2,3,4,4a,5,9b-hexahydro-, hydrochloride (1:2)

Description:
1H-Pyrido[4,3-b]indole, 8-chloro-2,3,4,4a,5,9b-hexahydro-, hydrochloride (1:2) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and indole moieties. The presence of a chlorine atom at the 8-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceutical research. The hexahydro configuration indicates that the compound is saturated, which may influence its pharmacokinetic properties. This compound is of interest in medicinal chemistry due to its potential interactions with biological targets, possibly exhibiting effects on neurotransmitter systems or other cellular pathways. Its CAS number, 1187931-90-3, allows for precise identification in chemical databases and literature. Overall, this compound represents a fascinating area of study for researchers exploring novel therapeutic agents.
Formula:C11H13ClN2·2ClH
InChI:InChI=1S/C11H13ClN2.2ClH/c12-7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10;;/h1-2,5,9,11,13-14H,3-4,6H2;2*1H
InChI key:InChIKey=GETBLWDBQVPKAW-UHFFFAOYSA-N
SMILES:ClC=1C=C2C3C(NC2=CC1)CCNC3.Cl
Synonyms:
  • 1H-Pyrido[4,3-b]indole, 8-chloro-2,3,4,4a,5,9b-hexahydro-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.