CymitQuimica logo

CAS 1187932-09-7

:

4-Pyridinol, 2-amino-, hydrochloride (1:1)

Description:
4-Pyridinol, 2-amino-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which features both an amino group and a hydroxyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The amino group contributes to its basicity, while the hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other substances. This compound may be of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential biological activity and ability to act as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Pyridinol, 2-amino-, hydrochloride is a versatile compound with notable chemical properties.
Formula:C5H6N2O·ClH
InChI:InChI=1S/C5H6N2O.ClH/c6-5-3-4(8)1-2-7-5;/h1-3H,(H3,6,7,8);1H
InChI key:InChIKey=DEVWTUWLHTYPTL-UHFFFAOYSA-N
SMILES:OC=1C=C(N)N=CC1.Cl
Synonyms:
  • 2-Aminopyridin-4-olhydrochloride
  • 4-Pyridinol, 2-amino-, hydrochloride (1:1)
Found 4 products.