CymitQuimica logo

CAS 1187932-12-2

:

2(1H)-Isoquinolinecarboxylic acid, 3-(aminomethyl)-3,4-dihydro-, 9H-fluoren-9-ylmethyl ester, hydrochloride (1:1), (3S)-

Description:
2(1H)-Isoquinolinecarboxylic acid, 3-(aminomethyl)-3,4-dihydro-, 9H-fluoren-9-ylmethyl ester, hydrochloride (1:1), (3S)- is a complex organic compound characterized by its isoquinoline and fluorenylmethyl moieties. This substance features a carboxylic acid functional group, which contributes to its acidic properties, and an amine group that can participate in hydrogen bonding and other interactions. The presence of the hydrochloride indicates that the compound is in its salt form, enhancing its solubility in polar solvents, which is often beneficial for biological activity and pharmacological applications. The stereochemistry, denoted by (3S), suggests that the compound has specific spatial arrangements that may influence its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry due to its potential therapeutic applications, particularly in the development of drugs targeting various biological pathways. Its structural complexity and functional groups suggest a range of possible interactions in biological systems, making it a candidate for further research in pharmacology and drug design.
Formula:C25H24N2O2·ClH
InChI:InChI=1S/C25H24N2O2.ClH/c26-14-19-13-17-7-1-2-8-18(17)15-27(19)25(28)29-16-24-22-11-5-3-9-20(22)21-10-4-6-12-23(21)24;/h1-12,19,24H,13-16,26H2;1H/t19-;/m0./s1
InChI key:InChIKey=VGEYJJHSMJNNCC-FYZYNONXSA-N
SMILES:C(OC(=O)N1[C@H](CN)CC=2C(C1)=CC=CC2)C3C=4C(C=5C3=CC=CC5)=CC=CC4.Cl
Synonyms:
  • 2(1H)-Isoquinolinecarboxylic acid, 3-(aminomethyl)-3,4-dihydro-, 9H-fluoren-9-ylmethyl ester, hydrochloride (1:1), (3S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.