CymitQuimica logo

CAS 1187932-29-1

:

1,1-Dimethylethyl 7-amino-6-bromo-3,4-dihydro-4,4-dimethyl-1(2H)-quinolinecarboxylate

Description:
1,1-Dimethylethyl 7-amino-6-bromo-3,4-dihydro-4,4-dimethyl-1(2H)-quinolinecarboxylate is a chemical compound characterized by its complex structure, which includes a quinoline core, a carboxylate group, and various substituents such as amino and bromo groups. The presence of the dimethyl group contributes to its steric hindrance, potentially influencing its reactivity and interactions with biological targets. This compound may exhibit properties typical of quinoline derivatives, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the amino and bromo substituents. Its solubility, stability, and reactivity can vary based on the functional groups attached to the quinoline framework. The CAS number 1187932-29-1 uniquely identifies this substance in chemical databases, facilitating research and regulatory processes. Overall, the characteristics of this compound suggest it may be of interest in medicinal chemistry and pharmacological studies, although specific experimental data would be necessary to fully understand its properties and potential applications.
Formula:C16H23BrN2O2
InChI:InChI=1S/C16H23BrN2O2/c1-15(2,3)21-14(20)19-7-6-16(4,5)10-8-11(17)12(18)9-13(10)19/h8-9H,6-7,18H2,1-5H3
InChI key:InChIKey=MSOKBBJQHCEINZ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C(C)(C)CC1)=CC(Br)=C(N)C2
Synonyms:
  • 1(2H)-Quinolinecarboxylic acid, 7-amino-6-bromo-3,4-dihydro-4,4-dimethyl-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 7-amino-6-bromo-3,4-dihydro-4,4-dimethyl-1(2H)-quinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.