CymitQuimica logo

CAS 1187932-30-4

:

3-Pyridinamine, 4-bromo-, hydrochloride (1:2)

Description:
3-Pyridinamine, 4-bromo-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 4-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in biological and chemical applications. The compound may exhibit properties such as basicity due to the nitrogen atom in the pyridine ring, allowing it to participate in protonation reactions. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Pyridinamine, 4-bromo-, hydrochloride (1:2) is a versatile compound with significant implications in chemical research and development.
Formula:C5H5BrN2·2ClH
InChI:InChI=1S/C5H5BrN2.2ClH/c6-4-1-2-8-3-5(4)7;;/h1-3H,7H2;2*1H
InChI key:InChIKey=VASGIDNQVOGCPY-UHFFFAOYSA-N
SMILES:BrC=1C(N)=CN=CC1.Cl
Synonyms:
  • 3-Pyridinamine, 4-bromo-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.