CymitQuimica logo

CAS 1187932-32-6

:

4-(2-Fluoro-4-hydrazinylphenyl)morpholine

Description:
4-(2-Fluoro-4-hydrazinylphenyl)morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a hydrazine functional group attached to a phenyl moiety that also contains a fluorine substituent. This compound typically exhibits properties associated with both hydrazine derivatives and morpholine, such as potential reactivity due to the presence of the hydrazine group, which can participate in various chemical reactions, including condensation and oxidation. The fluorine atom may influence the compound's lipophilicity and biological activity, potentially enhancing its interaction with biological targets. Additionally, the morpholine ring contributes to the compound's overall stability and solubility in polar solvents. Due to its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as compounds containing hydrazine derivatives can be hazardous. Always refer to safety data sheets and relevant literature for detailed information on handling and potential applications.
Formula:C10H14FN3O
InChI:InChI=1S/C10H14FN3O/c11-9-7-8(13-12)1-2-10(9)14-3-5-15-6-4-14/h1-2,7,13H,3-6,12H2
InChI key:InChIKey=AUSIFGRTYGEAHF-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(NN)=C1)N2CCOCC2
Synonyms:
  • 4-(2-Fluoro-4-hydrazinylphenyl)morpholine
  • Morpholine, 4-(2-fluoro-4-hydrazinylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.