
CAS 1187932-33-7
:Pyrrolidine, 3-(4-bromophenoxy)-, hydrochloride (1:1), (3S)-
Description:
Pyrrolidine, 3-(4-bromophenoxy)-, hydrochloride (1:1), (3S)- is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 4-bromophenoxy group indicates that a bromine atom is substituted on a phenyl ring, which is connected via an ether linkage to the pyrrolidine. This compound exists as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and pharmacology. The (3S)- designation refers to the specific stereochemistry at the third carbon of the pyrrolidine ring, indicating that it has a particular spatial arrangement that can influence its biological activity. As a hydrochloride salt, it typically exhibits improved stability and bioavailability compared to its free base form. The compound may be of interest in research related to neuropharmacology or as a potential therapeutic agent, although specific biological activities and applications would require further investigation.
Formula:C10H12BrNO·ClH
InChI:InChI=1S/C10H12BrNO.ClH/c11-8-1-3-9(4-2-8)13-10-5-6-12-7-10;/h1-4,10,12H,5-7H2;1H/t10-;/m0./s1
InChI key:InChIKey=FSPGQQCPSVBQPP-PPHPATTJSA-N
SMILES:O(C1=CC=C(Br)C=C1)[C@H]2CCNC2.Cl
Synonyms:- Pyrrolidine, 3-(4-bromophenoxy)-, hydrochloride (1:1), (3S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.