CymitQuimica logo

CAS 1187932-41-7

:

(3R)-1,2,3,4-Tetrahydro-3-isoquinolinemethanamine

Description:
(3R)-1,2,3,4-Tetrahydro-3-isoquinolinemethanamine is a chemical compound characterized by its bicyclic structure, which includes a tetrahydroisoquinoline moiety. This compound features a chiral center at the 3-position, contributing to its stereochemistry and potential biological activity. It is typically a colorless to pale yellow solid and is soluble in polar organic solvents. The presence of an amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural similarity to various bioactive compounds, potentially serving as a scaffold for drug development. Its specific applications and effects would depend on further studies, including pharmacological evaluations. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C10H14N2
InChI:InChI=1S/C10H14N2/c11-6-10-5-8-3-1-2-4-9(8)7-12-10/h1-4,10,12H,5-7,11H2/t10-/m1/s1
InChI key:InChIKey=QQDYNQIMTRERLH-SNVBAGLBSA-N
SMILES:C(N)[C@H]1CC=2C(CN1)=CC=CC2
Synonyms:
  • 3-Isoquinolinemethanamine, 1,2,3,4-tetrahydro-, (3R)-
  • (3R)-1,2,3,4-Tetrahydro-3-isoquinolinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.