CAS 1187932-45-1

2-Pyridinamine, 4-propyl-, hydrochloride (1:1)

Description:

2-Pyridinamine, 4-propyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) at the second position and a propyl group at the fourth position of the pyridine ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a crystalline form and is soluble in water, which enhances its utility in various applications. The presence of the amino group allows for potential reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may be of interest in pharmaceutical research and development due to its structural features that could influence biological activity. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-Pyridinamine, 4-propyl-, hydrochloride is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₈H₁₂N₂·ClH

InChI: InChI=1S/C8H12N2.ClH/c1-2-3-7-4-5-10-8(9)6-7;/h4-6H,2-3H2,1H3,(H2,9,10);1H

InChI key: InChIKey=KRSKRPDOVCWENX-UHFFFAOYSA-N

SMILES: C(CC)C=1C=C(N)N=CC1.Cl

Synonyms:

• 4-Propylpyridin-2-amine hydrochloride
• 2-Pyridinamine, 4-propyl-, hydrochloride (1:1)